C11H12BrFO4 — CID 117492085
ethyl 2-(3-bromo-2-fluoro-5-methoxyphenyl)-2-hydroxyacetate (PubChem CID 117492085) has the molecular formula C11H12BrFO4 and a molecular weight of 307.12 g/mol. Its IUPAC name is ethyl 2-(3-bromo-2-fluoro-5-methoxyphenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(3-bromo-2-fluoro-5-methoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117492085 |
| Molecular Formula | C11H12BrFO4 |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | ethyl 2-(3-bromo-2-fluoro-5-methoxyphenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(OC)cc(Br)c1F |
| InChI | InChI=1S/C11H12BrFO4/c1-3-17-11(15)10(14)7-4-6(16-2)5-8(12)9(7)13/h4-5,10,14H,3H2,1-2H3 |
| InChIKey | YYFDXQVBPXCZFK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |