C10H12FNO3 — CID 117303666
1-(7-fluoro-1,3-benzodioxol-5-yl)-2-(methylamino)ethanol (PubChem CID 117303666) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 1-(7-fluoro-1,3-benzodioxol-5-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(7-fluoro-1,3-benzodioxol-5-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117303666 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(7-fluoro-1,3-benzodioxol-5-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1cc(F)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H12FNO3/c1-12-4-8(13)6-2-7(11)10-9(3-6)14-5-15-10/h2-3,8,12-13H,4-5H2,1H3 |
| InChIKey | OHVKXZFPHVBXKC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |