C9H7FO5 — CID 117304924
2-(7-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid (PubChem CID 117304924) has the molecular formula C9H7FO5 and a molecular weight of 214.15 g/mol. Its IUPAC name is 2-(7-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(7-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117304924 |
| Molecular Formula | C9H7FO5 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-(7-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(F)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H7FO5/c10-5-1-4(7(11)9(12)13)2-6-8(5)15-3-14-6/h1-2,7,11H,3H2,(H,12,13) |
| InChIKey | KOXGXONXSIMZHI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |