C7H4F2O2 — CID 90413773
4,6-difluoro-1,3-benzodioxole (PubChem CID 90413773) has the molecular formula C7H4F2O2 and a molecular weight of 158.10 g/mol. Its IUPAC name is 4,6-difluoro-1,3-benzodioxole.
| Compound Name | 4,6-difluoro-1,3-benzodioxole |
|---|---|
| PubChem CID | 90413773 |
| Molecular Formula | C7H4F2O2 |
| Molecular Weight | 158.10 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 4,6-difluoro-1,3-benzodioxole |
| SMILES | Fc1cc(F)c2c(c1)OCO2 |
| InChI | InChI=1S/C7H4F2O2/c8-4-1-5(9)7-6(2-4)10-3-11-7/h1-2H,3H2 |
| InChIKey | VNGSOZLZQCZHPQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.10 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |