C8H6ClFO2 — CID 59129325
6-(chloromethyl)-4-fluoro-1,3-benzodioxole (PubChem CID 59129325) has the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. Its IUPAC name is 6-(chloromethyl)-4-fluoro-1,3-benzodioxole.
| Compound Name | 6-(chloromethyl)-4-fluoro-1,3-benzodioxole |
|---|---|
| PubChem CID | 59129325 |
| Molecular Formula | C8H6ClFO2 |
| Molecular Weight | 188.58 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | 6-(chloromethyl)-4-fluoro-1,3-benzodioxole |
| SMILES | Fc1cc(CCl)cc2c1OCO2 |
| InChI | InChI=1S/C8H6ClFO2/c9-3-5-1-6(10)8-7(2-5)11-4-12-8/h1-2H,3-4H2 |
| InChIKey | WOTGRYKCSXLUPJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|