C14H9BrF2O3 — CID 63894043
(7-bromo-1,3-benzodioxol-5-yl)-(3,5-difluorophenyl)methanol (PubChem CID 63894043) has the molecular formula C14H9BrF2O3 and a molecular weight of 343.12 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)-(3,5-difluorophenyl)methanol.
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)-(3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 63894043 |
| Molecular Formula | C14H9BrF2O3 |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)-(3,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)cc(F)c1)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H9BrF2O3/c15-11-3-8(4-12-14(11)20-6-19-12)13(18)7-1-9(16)5-10(17)2-7/h1-5,13,18H,6H2 |
| InChIKey | WQLGQLAYTUWLEQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |