C14H17BrO3 — CID 63896143
(7-bromo-1,3-benzodioxol-5-yl)-cyclohexylmethanol (PubChem CID 63896143) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)-cyclohexylmethanol.
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)-cyclohexylmethanol |
|---|---|
| PubChem CID | 63896143 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)-cyclohexylmethanol |
| SMILES | OC(c1cc(Br)c2c(c1)OCO2)C1CCCCC1 |
| InChI | InChI=1S/C14H17BrO3/c15-11-6-10(7-12-14(11)18-8-17-12)13(16)9-4-2-1-3-5-9/h6-7,9,13,16H,1-5,8H2 |
| InChIKey | DVCNFTYHURJILK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |