C13H11FO4 — CID 59988807
5-(7-fluoro-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione (PubChem CID 59988807) has the molecular formula C13H11FO4 and a molecular weight of 250.22 g/mol. Its IUPAC name is 5-(7-fluoro-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione.
| Compound Name | 5-(7-fluoro-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 59988807 |
| Molecular Formula | C13H11FO4 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-(7-fluoro-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)CC(c2cc(F)c3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H11FO4/c14-11-3-8(4-12-13(11)18-6-17-12)7-1-9(15)5-10(16)2-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | IQZDPOYWIIZMTK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|