C9H12N2O3 — CID 130632951
5-[(1S)-1,2-diaminoethyl]-1,3-benzodioxol-4-ol (PubChem CID 130632951) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-[(1S)-1,2-diaminoethyl]-1,3-benzodioxol-4-ol.
| Compound Name | 5-[(1S)-1,2-diaminoethyl]-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 130632951 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-[(1S)-1,2-diaminoethyl]-1,3-benzodioxol-4-ol |
| SMILES | NC[C@@H](N)c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C9H12N2O3/c10-3-6(11)5-1-2-7-9(8(5)12)14-4-13-7/h1-2,6,12H,3-4,10-11H2/t6-/m1/s1 |
| InChIKey | OCGWZHQETVULQG-ZCFIWIBFSA-N |
| XLogP | 0.08 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|