C10H11NO3 — CID 117283406
5-[(E)-3-aminoprop-1-enyl]-1,3-benzodioxol-4-ol (PubChem CID 117283406) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-1,3-benzodioxol-4-ol.
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117283406 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-1,3-benzodioxol-4-ol |
| SMILES | NC/C=C/c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C10H11NO3/c11-5-1-2-7-3-4-8-10(9(7)12)14-6-13-8/h1-4,12H,5-6,11H2/b2-1+ |
| InChIKey | ICZWXEAFEQOWRU-OWOJBTEDSA-N |
| XLogP | 1.09 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |