C10H10BrNO2 — CID 117393186
(E)-3-(6-bromo-1,3-benzodioxol-4-yl)prop-2-en-1-amine (PubChem CID 117393186) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is (E)-3-(6-bromo-1,3-benzodioxol-4-yl)prop-2-en-1-amine.
| Compound Name | (E)-3-(6-bromo-1,3-benzodioxol-4-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117393186 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (E)-3-(6-bromo-1,3-benzodioxol-4-yl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1cc(Br)cc2c1OCO2 |
| InChI | InChI=1S/C10H10BrNO2/c11-8-4-7(2-1-3-12)10-9(5-8)13-6-14-10/h1-2,4-5H,3,6,12H2/b2-1+ |
| InChIKey | UDCNJGYPPHRZGM-OWOJBTEDSA-N |
| XLogP | 2.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |