C11H14BrN — CID 117352410
(E)-3-(5-bromo-2,3-dimethylphenyl)prop-2-en-1-amine (PubChem CID 117352410) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is (E)-3-(5-bromo-2,3-dimethylphenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(5-bromo-2,3-dimethylphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117352410 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (E)-3-(5-bromo-2,3-dimethylphenyl)prop-2-en-1-amine |
| SMILES | Cc1cc(Br)cc(/C=C/CN)c1C |
| InChI | InChI=1S/C11H14BrN/c1-8-6-11(12)7-10(9(8)2)4-3-5-13/h3-4,6-7H,5,13H2,1-2H3/b4-3+ |
| InChIKey | WFJUPLNSHVEUTN-ONEGZZNKSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |