C12H15NO — CID 117281497
2-[(E)-3-aminoprop-1-enyl]-4,5-dimethylbenzaldehyde (PubChem CID 117281497) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[(E)-3-aminoprop-1-enyl]-4,5-dimethylbenzaldehyde.
| Compound Name | 2-[(E)-3-aminoprop-1-enyl]-4,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 117281497 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-[(E)-3-aminoprop-1-enyl]-4,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)c(/C=C/CN)cc1C |
| InChI | InChI=1S/C12H15NO/c1-9-6-11(4-3-5-13)12(8-14)7-10(9)2/h3-4,6-8H,5,13H2,1-2H3/b4-3+ |
| InChIKey | VQUHLHYJYVDAFX-ONEGZZNKSA-N |
| XLogP | 2.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|