C11H15NO — CID 117277547
6-[(E)-3-aminoprop-1-enyl]-2,3-dimethylphenol (PubChem CID 117277547) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-[(E)-3-aminoprop-1-enyl]-2,3-dimethylphenol.
| Compound Name | 6-[(E)-3-aminoprop-1-enyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 117277547 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 6-[(E)-3-aminoprop-1-enyl]-2,3-dimethylphenol |
| SMILES | Cc1ccc(/C=C/CN)c(O)c1C |
| InChI | InChI=1S/C11H15NO/c1-8-5-6-10(4-3-7-12)11(13)9(8)2/h3-6,13H,7,12H2,1-2H3/b4-3+ |
| InChIKey | LBECWKGLZQHONG-ONEGZZNKSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |