About 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol
5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol (PubChem CID 117308373) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol.
Molecular Properties
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol |
| PubChem CID | 117308373 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol |
| SMILES | Cc1[nH]c2ccc(/C=C/CN)c(O)c2c1C |
| InChI | InChI=1S/C13H16N2O/c1-8-9(2)15-11-6-5-10(4-3-7-14)13(16)12(8)11/h3-6,15-16H,7,14H2,1-2H3/b4-3+ |
| InChIKey | NBTZNCHODIUHFK-ONEGZZNKSA-N |
| XLogP | 2.46 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol?
The IUPAC name of 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol (CID 117308373) is 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol.
What is the SMILES notation for 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol?
The canonical SMILES for 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol is Cc1[nH]c2ccc(/C=C/CN)c(O)c2c1C.
What is the InChIKey of 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol?
The InChIKey is NBTZNCHODIUHFK-ONEGZZNKSA-N. The full InChI is InChI=1S/C13H16N2O/c1-8-9(2)15-11-6-5-10(4-3-7-14)13(16)12(8)11/h3-6,15-16H,7,14H2,1-2H3/b4-3+.
What are the key properties of 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol?
5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol has a molecular weight of 216.28 g/mol, XLogP of 2.46, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-3-aminoprop-1-enyl]-2,3-dimethyl-1H-indol-4-ol is sourced from PubChem (CID 117308373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).