2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid

C13H15NO3 — CID 84795947

IUPAC2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid
SMILESCc1[nH]c2ccc(O)c(C(C)C(=O)O)c2c1C
InChIInChI=1S/C13H15NO3/c1-6-8(3)14-9-4-5-10(15)12(11(6)9)7(2)13(16)17/h4-5,7,14-15H,1-3H3,(H,16,17)
InChIKeyYVQMZPKTIDSMGV-UHFFFAOYSA-N
MW233.27 g/mol
LogP2.68
Rot. Bonds2

About 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid

2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid (PubChem CID 84795947) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid
PubChem CID84795947
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Name2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid
SMILESCc1[nH]c2ccc(O)c(C(C)C(=O)O)c2c1C
InChIInChI=1S/C13H15NO3/c1-6-8(3)14-9-4-5-10(15)12(11(6)9)7(2)13(16)17/h4-5,7,14-15H,1-3H3,(H,16,17)
InChIKeyYVQMZPKTIDSMGV-UHFFFAOYSA-N
XLogP2.68
TPSA73.32 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 52.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid?
The IUPAC name of 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid (CID 84795947) is 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid.
What is the SMILES notation for 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid?
The canonical SMILES for 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid is Cc1[nH]c2ccc(O)c(C(C)C(=O)O)c2c1C.
What is the InChIKey of 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid?
The InChIKey is YVQMZPKTIDSMGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-6-8(3)14-9-4-5-10(15)12(11(6)9)7(2)13(16)17/h4-5,7,14-15H,1-3H3,(H,16,17).
What are the key properties of 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid?
2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid has a molecular weight of 233.27 g/mol, XLogP of 2.68, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-hydroxy-2,3-dimethyl-1H-indol-4-yl)propanoic acid is sourced from PubChem (CID 84795947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).