C9H10BrNO3 — CID 84710002
2-amino-2-(3-bromo-6-hydroxy-2-methylphenyl)acetic acid (PubChem CID 84710002) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is 2-amino-2-(3-bromo-6-hydroxy-2-methylphenyl)acetic acid.
| Compound Name | 2-amino-2-(3-bromo-6-hydroxy-2-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 84710002 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-amino-2-(3-bromo-6-hydroxy-2-methylphenyl)acetic acid |
| SMILES | Cc1c(Br)ccc(O)c1C(N)C(=O)O |
| InChI | InChI=1S/C9H10BrNO3/c1-4-5(10)2-3-6(12)7(4)8(11)9(13)14/h2-3,8,12H,11H2,1H3,(H,13,14) |
| InChIKey | JSKOSRBHIMXNPR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|