C10H12BrNO3 — CID 77129623
2-amino-2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)acetic acid (PubChem CID 77129623) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-amino-2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)acetic acid.
| Compound Name | 2-amino-2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 77129623 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-amino-2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)acetic acid |
| SMILES | Cc1c(Br)cc(C(N)C(=O)O)c(O)c1C |
| InChI | InChI=1S/C10H12BrNO3/c1-4-5(2)9(13)6(3-7(4)11)8(12)10(14)15/h3,8,13H,12H2,1-2H3,(H,14,15) |
| InChIKey | FTZUYLLLGXQISV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|