C10H10BrNO4 — CID 117464654
2-amino-2-(7-bromo-4-methyl-1,3-benzodioxol-5-yl)acetic acid (PubChem CID 117464654) has the molecular formula C10H10BrNO4 and a molecular weight of 288.10 g/mol. Its IUPAC name is 2-amino-2-(7-bromo-4-methyl-1,3-benzodioxol-5-yl)acetic acid.
| Compound Name | 2-amino-2-(7-bromo-4-methyl-1,3-benzodioxol-5-yl)acetic acid |
|---|---|
| PubChem CID | 117464654 |
| Molecular Formula | C10H10BrNO4 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 2-amino-2-(7-bromo-4-methyl-1,3-benzodioxol-5-yl)acetic acid |
| SMILES | Cc1c(C(N)C(=O)O)cc(Br)c2c1OCO2 |
| InChI | InChI=1S/C10H10BrNO4/c1-4-5(7(12)10(13)14)2-6(11)9-8(4)15-3-16-9/h2,7H,3,12H2,1H3,(H,13,14) |
| InChIKey | NJYBNNUJBFTLEF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |