2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid

C11H15NO4 — CID 77128761

IUPAC2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid
SMILESCOc1c(C)c(C)cc(C(N)C(=O)O)c1O
InChIInChI=1S/C11H15NO4/c1-5-4-7(8(12)11(14)15)9(13)10(16-3)6(5)2/h4,8,13H,12H2,1-3H3,(H,14,15)
InChIKeyRBLJYIHLCUYALK-UHFFFAOYSA-N
MW225.24 g/mol
LogP1.10
Rot. Bonds3

About 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid

2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid (PubChem CID 77128761) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid
PubChem CID77128761
Molecular FormulaC11H15NO4
Molecular Weight225.24 g/mol
Exact Mass225.10
IUPAC Name2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid
SMILESCOc1c(C)c(C)cc(C(N)C(=O)O)c1O
InChIInChI=1S/C11H15NO4/c1-5-4-7(8(12)11(14)15)9(13)10(16-3)6(5)2/h4,8,13H,12H2,1-3H3,(H,14,15)
InChIKeyRBLJYIHLCUYALK-UHFFFAOYSA-N
XLogP1.10
TPSA92.78 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.24
LogP ≤ 51.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid?
The IUPAC name of 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid (CID 77128761) is 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid?
The canonical SMILES for 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid is COc1c(C)c(C)cc(C(N)C(=O)O)c1O.
What is the InChIKey of 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid?
The InChIKey is RBLJYIHLCUYALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-5-4-7(8(12)11(14)15)9(13)10(16-3)6(5)2/h4,8,13H,12H2,1-3H3,(H,14,15).
What are the key properties of 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid?
2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid has a molecular weight of 225.24 g/mol, XLogP of 1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2-hydroxy-3-methoxy-4,5-dimethylphenyl)acetic acid is sourced from PubChem (CID 77128761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).