C11H13BrO3 — CID 83903974
2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)propanoic acid (PubChem CID 83903974) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)propanoic acid.
| Compound Name | 2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83903974 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(5-bromo-2-hydroxy-3,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1c(Br)cc(C(C)C(=O)O)c(O)c1C |
| InChI | InChI=1S/C11H13BrO3/c1-5-6(2)10(13)8(4-9(5)12)7(3)11(14)15/h4,7,13H,1-3H3,(H,14,15) |
| InChIKey | PHYUGGHYTLOTSA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |