C11H15NO3 — CID 84780586
2-amino-2-(3-hydroxy-2,4,6-trimethylphenyl)acetic acid (PubChem CID 84780586) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-amino-2-(3-hydroxy-2,4,6-trimethylphenyl)acetic acid.
| Compound Name | 2-amino-2-(3-hydroxy-2,4,6-trimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 84780586 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-2-(3-hydroxy-2,4,6-trimethylphenyl)acetic acid |
| SMILES | Cc1cc(C)c(C(N)C(=O)O)c(C)c1O |
| InChI | InChI=1S/C11H15NO3/c1-5-4-6(2)10(13)7(3)8(5)9(12)11(14)15/h4,9,13H,12H2,1-3H3,(H,14,15) |
| InChIKey | KBNBGABSRCDBIV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |