2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid

C10H12BrNO3 — CID 84810252

IUPAC2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid
SMILESCc1cc(O)c(C(N)C(=O)O)c(C)c1Br
InChIInChI=1S/C10H12BrNO3/c1-4-3-6(13)7(5(2)8(4)11)9(12)10(14)15/h3,9,13H,12H2,1-2H3,(H,14,15)
InChIKeyANAKUPJDVYDHOF-UHFFFAOYSA-N
MW274.11 g/mol
LogP1.86
Rot. Bonds2

About 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid

2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid (PubChem CID 84810252) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid
PubChem CID84810252
Molecular FormulaC10H12BrNO3
Molecular Weight274.11 g/mol
Exact Mass273.00
IUPAC Name2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid
SMILESCc1cc(O)c(C(N)C(=O)O)c(C)c1Br
InChIInChI=1S/C10H12BrNO3/c1-4-3-6(13)7(5(2)8(4)11)9(12)10(14)15/h3,9,13H,12H2,1-2H3,(H,14,15)
InChIKeyANAKUPJDVYDHOF-UHFFFAOYSA-N
XLogP1.86
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.11
LogP ≤ 51.86
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid?
The IUPAC name of 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid (CID 84810252) is 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid?
The canonical SMILES for 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid is Cc1cc(O)c(C(N)C(=O)O)c(C)c1Br.
What is the InChIKey of 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid?
The InChIKey is ANAKUPJDVYDHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO3/c1-4-3-6(13)7(5(2)8(4)11)9(12)10(14)15/h3,9,13H,12H2,1-2H3,(H,14,15).
What are the key properties of 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid?
2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid has a molecular weight of 274.11 g/mol, XLogP of 1.86, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(3-bromo-6-hydroxy-2,4-dimethylphenyl)acetic acid is sourced from PubChem (CID 84810252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).