C13H18BrClFNO3 — CID 171257644
ethyl (3S)-3-amino-3-(3-bromo-6-hydroxy-2,4-dimethylphenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171257644) has the molecular formula C13H18BrClFNO3 and a molecular weight of 370.65 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-bromo-6-hydroxy-2,4-dimethylphenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-bromo-6-hydroxy-2,4-dimethylphenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171257644 |
| Molecular Formula | C13H18BrClFNO3 |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-bromo-6-hydroxy-2,4-dimethylphenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1c(O)cc(C)c(Br)c1C.Cl |
| InChI | InChI=1S/C13H17BrFNO3.ClH/c1-4-19-13(18)11(15)12(16)9-7(3)10(14)6(2)5-8(9)17;/h5,11-12,17H,4,16H2,1-3H3;1H/t11?,12-;/m0./s1 |
| InChIKey | QUVIZKOISNKEKJ-MMFRDWCLSA-N |
| XLogP | 3.09 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|