C10H14BrNO2 — CID 131158931
2-[(1R)-1-amino-2-hydroxyethyl]-4-bromo-3,5-dimethylphenol (PubChem CID 131158931) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-hydroxyethyl]-4-bromo-3,5-dimethylphenol.
| Compound Name | 2-[(1R)-1-amino-2-hydroxyethyl]-4-bromo-3,5-dimethylphenol |
|---|---|
| PubChem CID | 131158931 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-[(1R)-1-amino-2-hydroxyethyl]-4-bromo-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c([C@@H](N)CO)c(C)c1Br |
| InChI | InChI=1S/C10H14BrNO2/c1-5-3-8(14)9(7(12)4-13)6(2)10(5)11/h3,7,13-14H,4,12H2,1-2H3/t7-/m0/s1 |
| InChIKey | OVJBWYMGRDCLGP-ZETCQYMHSA-N |
| XLogP | 1.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|