C15H24BrN — CID 114249229
1-(3-bromo-2,4,6-trimethylphenyl)hexan-1-amine (PubChem CID 114249229) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is 1-(3-bromo-2,4,6-trimethylphenyl)hexan-1-amine.
| Compound Name | 1-(3-bromo-2,4,6-trimethylphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 114249229 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-(3-bromo-2,4,6-trimethylphenyl)hexan-1-amine |
| SMILES | CCCCCC(N)c1c(C)cc(C)c(Br)c1C |
| InChI | InChI=1S/C15H24BrN/c1-5-6-7-8-13(17)14-10(2)9-11(3)15(16)12(14)4/h9,13H,5-8,17H2,1-4H3 |
| InChIKey | HNOSLPDHVTWBIG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|