C17H28O2Si — CID 10493897
6-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3-dimethylphenol (PubChem CID 10493897) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is 6-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3-dimethylphenol.
| Compound Name | 6-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 10493897 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 6-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3-dimethylphenol |
| SMILES | Cc1ccc(/C=C\CO[Si](C)(C)C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C17H28O2Si/c1-13-10-11-15(16(18)14(13)2)9-8-12-19-20(6,7)17(3,4)5/h8-11,18H,12H2,1-7H3/b9-8- |
| InChIKey | HXTFJVQCJLTCDO-HJWRWDBZSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|