C22H36O3Si — CID 16720182
2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-[(E)-3-phenylprop-2-enyl]propane-1,3-diol (PubChem CID 16720182) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-[(E)-3-phenylprop-2-enyl]propane-1,3-diol.
| Compound Name | 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-[(E)-3-phenylprop-2-enyl]propane-1,3-diol |
|---|---|
| PubChem CID | 16720182 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-[(E)-3-phenylprop-2-enyl]propane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/CC(CO)(CO)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H36O3Si/c1-21(2,3)26(4,5)25-17-10-9-15-22(18-23,19-24)16-11-14-20-12-7-6-8-13-20/h6-14,23-24H,15-19H2,1-5H3/b10-9+,14-11+ |
| InChIKey | FVTNWVXCTUBNBM-QDCWQMMGSA-N |
| XLogP | 5.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|