C15H23BO3Si — CID 101153950
[(Z)-3-(1,3,2-benzodioxaborol-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 101153950) has the molecular formula C15H23BO3Si and a molecular weight of 290.24 g/mol. Its IUPAC name is [(Z)-3-(1,3,2-benzodioxaborol-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(Z)-3-(1,3,2-benzodioxaborol-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101153950 |
| Molecular Formula | C15H23BO3Si |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(Z)-3-(1,3,2-benzodioxaborol-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C\B1Oc2ccccc2O1 |
| InChI | InChI=1S/C15H23BO3Si/c1-15(2,3)20(4,5)17-12-8-11-16-18-13-9-6-7-10-14(13)19-16/h6-11H,12H2,1-5H3/b11-8- |
| InChIKey | XKMPEEGJNPBGHT-FLIBITNWSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|