C15H31BO3Si — CID 10968526
tert-butyl-dimethyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane (PubChem CID 10968526) has the molecular formula C15H31BO3Si and a molecular weight of 298.31 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane |
|---|---|
| PubChem CID | 10968526 |
| Molecular Formula | C15H31BO3Si |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane |
| SMILES | CC1(C)OB(/C=C/CO[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C15H31BO3Si/c1-13(2,3)20(8,9)17-12-10-11-16-18-14(4,5)15(6,7)19-16/h10-11H,12H2,1-9H3/b11-10+ |
| InChIKey | LUURLZJMKOVITO-ZHACJKMWSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|