C21H38BNO5Si — CID 102361534
tert-butyl-[[4-[(E,1S)-1-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]-1,3-oxazol-2-yl]methoxy]-dimethylsilane (PubChem CID 102361534) has the molecular formula C21H38BNO5Si and a molecular weight of 423.44 g/mol. Its IUPAC name is tert-butyl-[[4-[(E,1S)-1-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]-1,3-oxazol-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-[(E,1S)-1-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]-1,3-oxazol-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102361534 |
| Molecular Formula | C21H38BNO5Si |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | tert-butyl-[[4-[(E,1S)-1-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]-1,3-oxazol-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@H](C/C=C/B1OC(C)(C)C(C)(C)O1)c1coc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C21H38BNO5Si/c1-19(2,3)29(9,10)26-15-18-23-16(14-25-18)17(24-8)12-11-13-22-27-20(4,5)21(6,7)28-22/h11,13-14,17H,12,15H2,1-10H3/b13-11+/t17-/m0/s1 |
| InChIKey | BXFCKQKKKGXUJD-HVJHFUJKSA-N |
| XLogP | 5.46 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|