C16H30BNO4Si — CID 155920954
tert-butyl-dimethyl-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane (PubChem CID 155920954) has the molecular formula C16H30BNO4Si and a molecular weight of 339.32 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 155920954 |
| Molecular Formula | C16H30BNO4Si |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl-dimethyl-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane |
| SMILES | CC1(C)OB(c2cnc(CO[Si](C)(C)C(C)(C)C)o2)OC1(C)C |
| InChI | InChI=1S/C16H30BNO4Si/c1-14(2,3)23(8,9)19-11-13-18-10-12(20-13)17-21-15(4,5)16(6,7)22-17/h10H,11H2,1-9H3 |
| InChIKey | KZEIJFKIDZLDMX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|