C20H32BNO4Si — CID 46737925
tert-butyl-dimethyl-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridin-2-yl]methoxy]silane (PubChem CID 46737925) has the molecular formula C20H32BNO4Si and a molecular weight of 389.38 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 46737925 |
| Molecular Formula | C20H32BNO4Si |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl-dimethyl-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridin-2-yl]methoxy]silane |
| SMILES | CC1(C)OB(c2cnc3cc(CO[Si](C)(C)C(C)(C)C)oc3c2)OC1(C)C |
| InChI | InChI=1S/C20H32BNO4Si/c1-18(2,3)27(8,9)23-13-15-11-16-17(24-15)10-14(12-22-16)21-25-19(4,5)20(6,7)26-21/h10-12H,13H2,1-9H3 |
| InChIKey | INHBSQTVWYQOCB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|