C21H35BN2O3Si — CID 170692410
tert-butyl-dimethyl-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethoxy]silane (PubChem CID 170692410) has the molecular formula C21H35BN2O3Si and a molecular weight of 402.42 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethoxy]silane |
|---|---|
| PubChem CID | 170692410 |
| Molecular Formula | C21H35BN2O3Si |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl-dimethyl-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethoxy]silane |
| SMILES | CC1(C)OB(c2ccc3c(cnn3CCO[Si](C)(C)C(C)(C)C)c2)OC1(C)C |
| InChI | InChI=1S/C21H35BN2O3Si/c1-19(2,3)28(8,9)25-13-12-24-18-11-10-17(14-16(18)15-23-24)22-26-20(4,5)21(6,7)27-22/h10-11,14-15H,12-13H2,1-9H3 |
| InChIKey | DPQOENKWHUXCAM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|