C36H52B2N4O5Si — CID 157133258
tert-butyl-diphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethoxy]silane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 157133258) has the molecular formula C36H52B2N4O5Si and a molecular weight of 670.55 g/mol. Its IUPAC name is tert-butyl-diphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethoxy]silane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | tert-butyl-diphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethoxy]silane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 157133258 |
| Molecular Formula | C36H52B2N4O5Si |
| Molecular Weight | 670.55 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | tert-butyl-diphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethoxy]silane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2cn[nH]c2)OC1(C)C.CC1(C)OB(c2cnn(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)OC1(C)C |
| InChI | InChI=1S/C27H37BN2O3Si.C9H15BN2O2/c1-25(2,3)34(23-14-10-8-11-15-23,24-16-12-9-13-17-24)31-19-18-30-21-22(20-29-30)28-32-26(4,5)27(6,7)33-28;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h8-17,20-21H,18-19H2,1-7H3;5-6H,1-4H3,(H,11,12) |
| InChIKey | AJHYXQUNJHSDLN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|