C32H45BN2O3Si — CID 162725493
tert-butyl-diphenyl-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexyl]methoxy]silane (PubChem CID 162725493) has the molecular formula C32H45BN2O3Si and a molecular weight of 544.62 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexyl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexyl]methoxy]silane |
|---|---|
| PubChem CID | 162725493 |
| Molecular Formula | C32H45BN2O3Si |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | tert-butyl-diphenyl-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexyl]methoxy]silane |
| SMILES | CC1(C)OB(c2cnn(C3CCC(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CC3)c2)OC1(C)C |
| InChI | InChI=1S/C32H45BN2O3Si/c1-30(2,3)39(28-14-10-8-11-15-28,29-16-12-9-13-17-29)36-24-25-18-20-27(21-19-25)35-23-26(22-34-35)33-37-31(4,5)32(6,7)38-33/h8-17,22-23,25,27H,18-21,24H2,1-7H3 |
| InChIKey | UAVGNKOTUKMMBH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|