C12H19B2N3O2 — CID 164585973
CID 164585973 (PubChem CID 164585973) has the molecular formula C12H19B2N3O2 and a molecular weight of 258.93 g/mol.
| Compound Name | CID 164585973 |
|---|---|
| PubChem CID | 164585973 |
| Molecular Formula | C12H19B2N3O2 |
| Molecular Weight | 258.93 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | — |
| SMILES | [B]N1CC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C12H19B2N3O2/c1-11(2)12(3,4)19-14(18-11)9-5-15-17(6-9)10-7-16(13)8-10/h5-6,10H,7-8H2,1-4H3 |
| InChIKey | FIBUVYULBWUVCN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.93 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|