C13H22BN3O2 — CID 99866972
1-[(3S)-pyrrolidin-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 99866972) has the molecular formula C13H22BN3O2 and a molecular weight of 263.15 g/mol. Its IUPAC name is 1-[(3S)-pyrrolidin-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[(3S)-pyrrolidin-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 99866972 |
| Molecular Formula | C13H22BN3O2 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 1-[(3S)-pyrrolidin-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(C)OB(c2cnn([C@H]3CCNC3)c2)OC1(C)C |
| InChI | InChI=1S/C13H22BN3O2/c1-12(2)13(3,4)19-14(18-12)10-7-16-17(9-10)11-5-6-15-8-11/h7,9,11,15H,5-6,8H2,1-4H3/t11-/m0/s1 |
| InChIKey | ADJWDMNNAGNZPJ-NSHDSACASA-N |
| XLogP | 0.72 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|