C13H23BN2O3 — CID 146695577
4-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1-(2-methoxyethyl)pyrazole (PubChem CID 146695577) has the molecular formula C13H23BN2O3 and a molecular weight of 266.15 g/mol. Its IUPAC name is 4-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1-(2-methoxyethyl)pyrazole.
| Compound Name | 4-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1-(2-methoxyethyl)pyrazole |
|---|---|
| PubChem CID | 146695577 |
| Molecular Formula | C13H23BN2O3 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1-(2-methoxyethyl)pyrazole |
| SMILES | CCC1(C)OB(c2cnn(CCOC)c2)OC1(C)C |
| InChI | InChI=1S/C13H23BN2O3/c1-6-13(4)12(2,3)18-14(19-13)11-9-15-16(10-11)7-8-17-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | QODDHOZAKSJTQV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|