C31H42BNO3Si — CID 171455039
N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 171455039) has the molecular formula C31H42BNO3Si and a molecular weight of 515.58 g/mol. Its IUPAC name is N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 171455039 |
| Molecular Formula | C31H42BNO3Si |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C31H42BNO3Si/c1-29(2,3)37(27-15-11-9-12-16-27,28-17-13-10-14-18-28)34-24-23-33(8)26-21-19-25(20-22-26)32-35-30(4,5)31(6,7)36-32/h9-22H,23-24H2,1-8H3 |
| InChIKey | KFXVTOVFNDDFDA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|