C30H40BNO5Si — CID 123245037
N-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methoxyhydroxylamine (PubChem CID 123245037) has the molecular formula C30H40BNO5Si and a molecular weight of 533.55 g/mol. Its IUPAC name is N-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methoxyhydroxylamine.
| Compound Name | N-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methoxyhydroxylamine |
|---|---|
| PubChem CID | 123245037 |
| Molecular Formula | C30H40BNO5Si |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | N-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methoxyhydroxylamine |
| SMILES | CON(O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H40BNO5Si/c1-28(2,3)38(23-16-11-9-12-17-23,24-18-13-10-14-19-24)35-22-25-26(20-15-21-27(25)32(33)34-8)31-36-29(4,5)30(6,7)37-31/h9-21,33H,22H2,1-8H3 |
| InChIKey | WMPAJTCIQGGRII-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|