C29H45BO3Si — CID 154585580
tert-butyl-[(3S)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]-diphenylsilane (PubChem CID 154585580) has the molecular formula C29H45BO3Si and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl-[(3S)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3S)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 154585580 |
| Molecular Formula | C29H45BO3Si |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | tert-butyl-[(3S)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]-diphenylsilane |
| SMILES | CC(C)C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H45BO3Si/c1-23(2)22-24(30-32-28(6,7)29(8,9)33-30)20-21-31-34(27(3,4)5,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-19,23-24H,20-22H2,1-9H3/t24-/m1/s1 |
| InChIKey | DIKYZKDANUFSOJ-XMMPIXPASA-N |
| XLogP | 6.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|