C24H33BN2O3 — CID 102175312
N,N-diethyl-2-(N-methylanilino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 102175312) has the molecular formula C24H33BN2O3 and a molecular weight of 408.35 g/mol. Its IUPAC name is N,N-diethyl-2-(N-methylanilino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N,N-diethyl-2-(N-methylanilino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 102175312 |
| Molecular Formula | C24H33BN2O3 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N,N-diethyl-2-(N-methylanilino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1c(B2OC(C)(C)C(C)(C)O2)cccc1N(C)c1ccccc1 |
| InChI | InChI=1S/C24H33BN2O3/c1-8-27(9-2)22(28)21-19(25-29-23(3,4)24(5,6)30-25)16-13-17-20(21)26(7)18-14-11-10-12-15-18/h10-17H,8-9H2,1-7H3 |
| InChIKey | ALZNPOVBNDDQGS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|