C31H44BN3O4Si — CID 150977342
N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methoxy-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 150977342) has the molecular formula C31H44BN3O4Si and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methoxy-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methoxy-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 150977342 |
| Molecular Formula | C31H44BN3O4Si |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methoxy-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | COc1nc(N(C)CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C31H44BN3O4Si/c1-29(2,3)40(24-17-12-10-13-18-24,25-19-14-11-15-20-25)37-22-16-21-35(8)28-33-23-26(27(34-28)36-9)32-38-30(4,5)31(6,7)39-32/h10-15,17-20,23H,16,21-22H2,1-9H3 |
| InChIKey | LPJFPLNSFYCFQI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|