C22H40BNO3Si — CID 10787457
N-tert-butyl-N-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 10787457) has the molecular formula C22H40BNO3Si and a molecular weight of 405.46 g/mol. Its IUPAC name is N-tert-butyl-N-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-tert-butyl-N-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 10787457 |
| Molecular Formula | C22H40BNO3Si |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N-tert-butyl-N-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC(C)(C)N(O[Si](C)(C)C(C)(C)C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H40BNO3Si/c1-19(2,3)24(27-28(11,12)20(4,5)6)18-15-13-17(14-16-18)23-25-21(7,8)22(9,10)26-23/h13-16H,1-12H3 |
| InChIKey | ZBKMUFRIJQHQKO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|