C16H16BF9O3 — CID 168800360
2-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 168800360) has the molecular formula C16H16BF9O3 and a molecular weight of 438.10 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 168800360 |
| Molecular Formula | C16H16BF9O3 |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C16H16BF9O3/c1-11(2)12(3,4)29-17(28-11)9-5-7-10(8-6-9)27-13(14(18,19)20,15(21,22)23)16(24,25)26/h5-8H,1-4H3 |
| InChIKey | YHFFQLBVDKHTAY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.10 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|