C17H26BNO5 — CID 90157218
[2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamic acid (PubChem CID 90157218) has the molecular formula C17H26BNO5 and a molecular weight of 335.21 g/mol. Its IUPAC name is [2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamic acid.
| Compound Name | [2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamic acid |
|---|---|
| PubChem CID | 90157218 |
| Molecular Formula | C17H26BNO5 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamic acid |
| SMILES | CC(C)(CNC(=O)O)Oc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H26BNO5/c1-15(2,11-19-14(20)21)22-13-9-7-12(8-10-13)18-23-16(3,4)17(5,6)24-18/h7-10,19H,11H2,1-6H3,(H,20,21) |
| InChIKey | AWPVXKLPMHKPIO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|