C20H19BF3NO3 — CID 123954778
2-[4-[4-isocyano-3-(trifluoromethyl)phenoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123954778) has the molecular formula C20H19BF3NO3 and a molecular weight of 389.18 g/mol. Its IUPAC name is 2-[4-[4-isocyano-3-(trifluoromethyl)phenoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[4-isocyano-3-(trifluoromethyl)phenoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123954778 |
| Molecular Formula | C20H19BF3NO3 |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[4-[4-isocyano-3-(trifluoromethyl)phenoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19BF3NO3/c1-18(2)19(3,4)28-21(27-18)13-6-8-14(9-7-13)26-15-10-11-17(25-5)16(12-15)20(22,23)24/h6-12H,1-4H3 |
| InChIKey | WQSXGDWWBWJCHC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|