C18H19BFO3+ — CID 123902177
2-[4-(4-fluorophenoxy)phenyl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane (PubChem CID 123902177) has the molecular formula C18H19BFO3+ and a molecular weight of 313.16 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123902177 |
| Molecular Formula | C18H19BFO3+ |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane |
| SMILES | [CH2+]C1(C)OB(c2ccc(Oc3ccc(F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H19BFO3/c1-17(2)18(3,4)23-19(22-17)13-5-9-15(10-6-13)21-16-11-7-14(20)8-12-16/h5-12H,1H2,2-4H3/q+1 |
| InChIKey | ILMGRIWIKKOBDL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|