C20H23BF2O4 — CID 113249696
2-[4-[2-(2,5-difluorophenoxy)ethoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 113249696) has the molecular formula C20H23BF2O4 and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-[4-[2-(2,5-difluorophenoxy)ethoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2-(2,5-difluorophenoxy)ethoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113249696 |
| Molecular Formula | C20H23BF2O4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[4-[2-(2,5-difluorophenoxy)ethoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OCCOc3cc(F)ccc3F)cc2)OC1(C)C |
| InChI | InChI=1S/C20H23BF2O4/c1-19(2)20(3,4)27-21(26-19)14-5-8-16(9-6-14)24-11-12-25-18-13-15(22)7-10-17(18)23/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | DRIUOKDUTKHIDZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|